Molecular Definition

Canonical SMILES Oc1ccc(cc1)C2=COc3cc(OCC=C)ccc3C2=O
Formula C18H14O4
Molecular Weight 294.30 da
Stereocenters 0/0