Target Relevance

Molecular Definition

Canonical SMILES CCS(=O)(=O)Nc1cccc2C(CCc12)c3c[nH]cn3
Formula C14H17N3O2S
Molecular Weight 291.37 da
Stereocenters 0/1