Molecular Definition

Canonical SMILES C[N+]1(C)C2CCC1CC(C2)OC(=O)c3c[nH]c4ccccc34
Formula C18H23N2O2
Molecular Weight 299.39 da
Stereocenters 0/3