Molecular Definition

Canonical SMILES CC(C)c1c(O)c(O)c2C(=O)Oc3c(c(C)cc1c23)c4c(C)cc5c(C(C)C)c(O)c(O)c6C(=O)Oc4c56
Formula C30H26O8
Molecular Weight 514.52 da
Stereocenters 0/0