Molecular Definition

Canonical SMILES C[C@H](CC1=NC2C(C=NN2c3ccccc3Cl)C(=O)N1)C(F)(F)F
Formula C15H14ClF3N4O
Molecular Weight 358.75 da
Stereocenters 1/3