Molecular Definition

Canonical SMILES N[C@@H](CCCNC(=N)N)C(=O)NCCCNCCCNCCCCCNC(=O)[C@H](CC(=O)N)NC(=O)Cc1ccc(O)cc1O
Formula C29H52N10O6
Molecular Weight 636.79 da
Stereocenters 2/2