Molecular Definition

Canonical SMILES CC(C)S(=O)(=O)NCC(C)C1CCC(CC1)c2ccc(cc2)C#N
Formula C19H28N2O2S
Molecular Weight 348.50 da
Stereocenters 0/1