Molecular Definition

Canonical SMILES CN(C)CCNC(=O)Nc1ccc(cc1)c2nc(N3CCOCC3)c4cnn(C5CCN(Cc6ccccc6)CC5)c4n2
Formula C32H41N9O2
Molecular Weight 583.73 da
Stereocenters 0/0