Target Relevance

Molecular Definition

Canonical SMILES CC(C)\N=C\1/S\C(=C/c2ccc(OCCO)cc2)\C(=O)N1c3ccccc3
Formula C21H22N2O3S
Molecular Weight 382.48 da
Stereocenters 0/0