Molecular Definition

Canonical SMILES CC(C)\N=C\1/S\C(=C/c2ccc(CCCO)cc2)\C(=O)N1c3ccccc3
Formula C22H24N2O2S
Molecular Weight 380.50 da
Stereocenters 0/0