Molecular Definition

Canonical SMILES CC(=O)NCCc1cccc2ccc(OCCCCOc3ccc4[nH]cc(CCNC(=O)C)c4c3)cc12
Formula C30H35N3O4
Molecular Weight 501.62 da
Stereocenters 0/0