Molecular Definition

Canonical SMILES CCC(C)(C)Cc1c[nH]c(CCc2ccc(cc2)c3ccccn3)n1
Formula C22H27N3
Molecular Weight 333.47 da
Stereocenters 0/0