Molecular Definition

Canonical SMILES CN(CCCN1C(=O)[C@H]2Cc3ccccc3CN2C1=O)Cc4ccccc4
Formula C22H25N3O2
Molecular Weight 363.45 da
Stereocenters 1/1