Target Relevance

Molecular Definition

Canonical SMILES CCC(C)(C)Cc1c[nH]c(CCc2ccc(cc2)c3cnccn3)n1
Formula C21H26N4
Molecular Weight 334.46 da
Stereocenters 0/0