Molecular Definition

Canonical SMILES [Na+].OP(=O)([O-])OC1C=C(Nc2cc3OCOc3cc12)c4ccccc4F
Formula C16H12FNNaO6P
Molecular Weight 387.23 da
Stereocenters 0/1