Molecular Definition

Canonical SMILES COc1cccc(OC)c1OCCNCC2COC(O2)(c3ccccc3)c4ccccc4
Formula C26H29NO5
Molecular Weight 435.51 da
Stereocenters 0/1