Target Relevance

Molecular Definition

Canonical SMILES CCC(C)(C)Cc1c[nH]c(CCc2ccc(cc2)c3ccccc3OCc4cnn[nH]4)n1
Formula C26H31N5O
Molecular Weight 429.56 da
Stereocenters 0/0