Target Relevance

Molecular Definition

Canonical SMILES CC(CN1CC2CCCCC2C(C1)C(=O)N3CCN(CC3)c4ccc5nsnc5n4)Cc6ccc7OCOc7c6
Formula C30H38N6O3S
Molecular Weight 562.73 da
Stereocenters 0/4