Molecular Definition

Canonical SMILES CN(C(=N)NC(=O)c1ccc(C)cc1)c2cccc(I)c2
Formula C16H16IN3O
Molecular Weight 393.22 da
Stereocenters 0/0