Molecular Definition

Canonical SMILES OC(COc1cccc2[nH]c3ccccc3c12)CN4CCC(CC4)N5C(=O)c6cccc7cccc(C5=O)c67
Formula C32H29N3O4
Molecular Weight 519.59 da
Stereocenters 0/1