Target Relevance

Molecular Definition

Canonical SMILES CC(CN1CC2CCCCC2C(C1)C(=O)N3CCN(CC3)c4ccc(Cl)cn4)Cc5ccc6OCOc6c5
Formula C30H39ClN4O3
Molecular Weight 539.11 da
Stereocenters 0/4