Target Relevance

Molecular Definition

Canonical SMILES CCC(CO)Nc1nc(Nc2cccc(c2)c3ccccn3)c4ncn(C(C)C)c4n1
Formula C23H27N7O
Molecular Weight 417.51 da
Stereocenters 0/1