Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(cc1)S(=O)(=O)N2[C@@H]3CC[C@H]2CC(O)C3
Formula C17H25NO3S
Molecular Weight 323.45 da
Stereocenters 2/3