Target Relevance

Molecular Definition

Canonical SMILES CC(CN1CC2CCCCC2C(C1)C(=O)N3CCN(CC3)c4cccc5nonc45)Cc6ccc7OCOc7c6
Formula C31H39N5O4
Molecular Weight 545.67 da
Stereocenters 0/4