Target Relevance

Molecular Definition

Canonical SMILES CC(CN1CC2CCCCC2C(C1)C(=O)N3CCN(CC3)c4ccc(cn4)C#N)Cc5ccc6OCOc6c5
Formula C31H39N5O3
Molecular Weight 529.67 da
Stereocenters 0/4