Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CNCCc1ccc(NC(=O)c2ccc(CCc3ccccc3)cc2)cc1)c4cccnc4
Formula C30H31N3O2
Molecular Weight 465.59 da
Stereocenters 1/1