Target Relevance

Molecular Definition

Canonical SMILES CCCc1cc(nc(n1)C#N)c2ccccc2
Formula C14H13N3
Molecular Weight 223.27 da
Stereocenters 0/0