Molecular Definition

Canonical SMILES Clc1ccc(cc1Cl)C(=O)NC(=N)NCCCCc2ccccc2
Formula C18H19Cl2N3O
Molecular Weight 364.27 da
Stereocenters 0/0