Molecular Definition

Canonical SMILES CC(C)c1ccccc1\N=C(\N)/NC(=O)c2ccc(C)cc2
Formula C18H21N3O
Molecular Weight 295.38 da
Stereocenters 0/0