Molecular Definition

Canonical SMILES NC(=N)c1ccc2cc(cc(C3CCOC3)c2c1)C(=O)Nc4ccccc4
Formula C22H21N3O2
Molecular Weight 359.42 da
Stereocenters 0/1