Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc(cc1)[C@@H](Cc2ccccc2)NC[C@H](O)c3ccc(O)c(NS(=O)(=O)C)c3
Formula C25H28N2O6S
Molecular Weight 484.57 da
Stereocenters 2/2