Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2)C(=O)N[C@H]3CC(=O)OC3O
Formula C27H33N3O7
Molecular Weight 511.57 da
Stereocenters 3/4