Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H]([C@H](CN(C)S(=O)(=O)C)C(=O)NO)C(=O)N(C)C
Formula C13H27N3O5S
Molecular Weight 337.44 da
Stereocenters 2/2