Molecular Definition

Canonical SMILES O=C(N1CCN(CC1)Cc1ccc(cc1N1CCCC1)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F
Formula C20H22F9N3O2
Molecular Weight 507.39 da
Stereocenters 0/0