Molecular Definition

Canonical SMILES CN[C@@H]1C[C@H]2O[C@]([C@@H]1OC)(C)n1c3ccccc3c3c1c1n2c2ccccc2c1c1c3[C@H](NC1=O)O
Formula C28H26N4O4
Molecular Weight 482.53 da
Stereocenters 5/5