Molecular Definition

Canonical SMILES CCCC(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2
Formula C17H24N2O
Molecular Weight 272.39 da
Stereocenters 0/0