Target Relevance

Molecular Definition

Canonical SMILES OC(=O)CC(CCCP(=O)(O)O)(O)C
Formula C7H15O6P
Molecular Weight 226.16 da
Stereocenters 0/1